C12H16OS — CID 13331329
2-butyl-2-methyl-1,3-benzoxathiole (PubChem CID 13331329) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-butyl-2-methyl-1,3-benzoxathiole.
| Compound Name | 2-butyl-2-methyl-1,3-benzoxathiole |
|---|---|
| PubChem CID | 13331329 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-butyl-2-methyl-1,3-benzoxathiole |
| SMILES | CCCCC1(C)Oc2ccccc2S1 |
| InChI | InChI=1S/C12H16OS/c1-3-4-9-12(2)13-10-7-5-6-8-11(10)14-12/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | ZXPPRLZVGKMIIA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |