C12H14O3S — CID 15154819
methyl 2-(2-methyl-1,3-benzoxathiol-2-yl)propanoate (PubChem CID 15154819) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl 2-(2-methyl-1,3-benzoxathiol-2-yl)propanoate.
| Compound Name | methyl 2-(2-methyl-1,3-benzoxathiol-2-yl)propanoate |
|---|---|
| PubChem CID | 15154819 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | methyl 2-(2-methyl-1,3-benzoxathiol-2-yl)propanoate |
| SMILES | COC(=O)C(C)C1(C)Oc2ccccc2S1 |
| InChI | InChI=1S/C12H14O3S/c1-8(11(13)14-3)12(2)15-9-6-4-5-7-10(9)16-12/h4-8H,1-3H3 |
| InChIKey | VSGMRTPEGWBIRM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |