C17H28N2O2 — CID 106036554
methyl 3-[3-[methyl(propan-2-yl)amino]propylamino]-2-phenylpropanoate (PubChem CID 106036554) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is methyl 3-[3-[methyl(propan-2-yl)amino]propylamino]-2-phenylpropanoate.
| Compound Name | methyl 3-[3-[methyl(propan-2-yl)amino]propylamino]-2-phenylpropanoate |
|---|---|
| PubChem CID | 106036554 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | methyl 3-[3-[methyl(propan-2-yl)amino]propylamino]-2-phenylpropanoate |
| SMILES | COC(=O)C(CNCCCN(C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O2/c1-14(2)19(3)12-8-11-18-13-16(17(20)21-4)15-9-6-5-7-10-15/h5-7,9-10,14,16,18H,8,11-13H2,1-4H3 |
| InChIKey | JFHUCHVHNPGEFV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|