C15H24N2O2 — CID 64567480
methyl 3-[3-(dimethylamino)propylamino]-2-phenylpropanoate (PubChem CID 64567480) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl 3-[3-(dimethylamino)propylamino]-2-phenylpropanoate.
| Compound Name | methyl 3-[3-(dimethylamino)propylamino]-2-phenylpropanoate |
|---|---|
| PubChem CID | 64567480 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | methyl 3-[3-(dimethylamino)propylamino]-2-phenylpropanoate |
| SMILES | COC(=O)C(CNCCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O2/c1-17(2)11-7-10-16-12-14(15(18)19-3)13-8-5-4-6-9-13/h4-6,8-9,14,16H,7,10-12H2,1-3H3 |
| InChIKey | BIQAFHOCIWBAOH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|