C17H18OS3 — CID 12652370
2-(2-butyl-1,3-benzodithiol-2-yl)-1-thiophen-2-ylethanone (PubChem CID 12652370) has the molecular formula C17H18OS3 and a molecular weight of 334.53 g/mol. Its IUPAC name is 2-(2-butyl-1,3-benzodithiol-2-yl)-1-thiophen-2-ylethanone.
| Compound Name | 2-(2-butyl-1,3-benzodithiol-2-yl)-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 12652370 |
| Molecular Formula | C17H18OS3 |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2-(2-butyl-1,3-benzodithiol-2-yl)-1-thiophen-2-ylethanone |
| SMILES | CCCCC1(CC(=O)c2cccs2)Sc2ccccc2S1 |
| InChI | InChI=1S/C17H18OS3/c1-2-3-10-17(12-13(18)14-9-6-11-19-14)20-15-7-4-5-8-16(15)21-17/h4-9,11H,2-3,10,12H2,1H3 |
| InChIKey | JXSQIJQLUQJGAK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |