About 2-ethyl-2-propyl-3,1-benzoxathiin-4-one
2-ethyl-2-propyl-3,1-benzoxathiin-4-one (PubChem CID 176765986) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-ethyl-2-propyl-3,1-benzoxathiin-4-one.
Molecular Properties
| Compound Name | 2-ethyl-2-propyl-3,1-benzoxathiin-4-one |
| PubChem CID | 176765986 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-ethyl-2-propyl-3,1-benzoxathiin-4-one |
| SMILES | CCCC1(CC)OC(=O)c2ccccc2S1 |
| InChI | InChI=1S/C13H16O2S/c1-3-9-13(4-2)15-12(14)10-7-5-6-8-11(10)16-13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | RKTKGEIIOYYNPS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2-propyl-3,1-benzoxathiin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-propyl-3,1-benzoxathiin-4-one?
The IUPAC name of 2-ethyl-2-propyl-3,1-benzoxathiin-4-one (CID 176765986) is 2-ethyl-2-propyl-3,1-benzoxathiin-4-one.
What is the SMILES notation for 2-ethyl-2-propyl-3,1-benzoxathiin-4-one?
The canonical SMILES for 2-ethyl-2-propyl-3,1-benzoxathiin-4-one is CCCC1(CC)OC(=O)c2ccccc2S1.
What is the InChIKey of 2-ethyl-2-propyl-3,1-benzoxathiin-4-one?
The InChIKey is RKTKGEIIOYYNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2S/c1-3-9-13(4-2)15-12(14)10-7-5-6-8-11(10)16-13/h5-8H,3-4,9H2,1-2H3.
What are the key properties of 2-ethyl-2-propyl-3,1-benzoxathiin-4-one?
2-ethyl-2-propyl-3,1-benzoxathiin-4-one has a molecular weight of 236.34 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-propyl-3,1-benzoxathiin-4-one is sourced from PubChem (CID 176765986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).