C19H28O2S — CID 98093388
(2S)-2-undecyl-3,1-benzoxathiin-4-one (PubChem CID 98093388) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is (2S)-2-undecyl-3,1-benzoxathiin-4-one.
| Compound Name | (2S)-2-undecyl-3,1-benzoxathiin-4-one |
|---|---|
| PubChem CID | 98093388 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2S)-2-undecyl-3,1-benzoxathiin-4-one |
| SMILES | CCCCCCCCCCC[C@H]1OC(=O)c2ccccc2S1 |
| InChI | InChI=1S/C19H28O2S/c1-2-3-4-5-6-7-8-9-10-15-18-21-19(20)16-13-11-12-14-17(16)22-18/h11-14,18H,2-10,15H2,1H3/t18-/m0/s1 |
| InChIKey | PLXQGGOKMAIBCY-SFHVURJKSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|