About 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one
2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one (PubChem CID 161321565) has the molecular formula C21H23BrO4
and a molecular weight of 419.32 g/mol. Its IUPAC name is 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one |
| PubChem CID | 161321565 |
| Molecular Formula | C21H23BrO4 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one |
| SMILES | CCCCCCC1OC(=O)c2ccccc21.O=C(O)c1ccccc1Br |
| InChI | InChI=1S/C14H18O2.C7H5BrO2/c1-2-3-4-5-10-13-11-8-6-7-9-12(11)14(15)16-13;8-6-4-2-1-3-5(6)7(9)10/h6-9,13H,2-5,10H2,1H3;1-4H,(H,9,10) |
| InChIKey | VKFDCYZMDMOKNL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one?
The IUPAC name of 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one (CID 161321565) is 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one.
What is the SMILES notation for 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one?
The canonical SMILES for 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one is CCCCCCC1OC(=O)c2ccccc21.O=C(O)c1ccccc1Br.
What is the InChIKey of 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one?
The InChIKey is VKFDCYZMDMOKNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2.C7H5BrO2/c1-2-3-4-5-10-13-11-8-6-7-9-12(11)14(15)16-13;8-6-4-2-1-3-5(6)7(9)10/h6-9,13H,2-5,10H2,1H3;1-4H,(H,9,10).
What are the key properties of 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one?
2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one has a molecular weight of 419.32 g/mol, XLogP of 6.02, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzoic acid;3-hexyl-3H-2-benzofuran-1-one is sourced from PubChem (CID 161321565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).