C18H20O2 — CID 102077062
6-deuterio-6-pentylbenzo[d][1,3]benzodioxepine (PubChem CID 102077062) has the molecular formula C18H20O2 and a molecular weight of 269.36 g/mol. Its IUPAC name is 6-deuterio-6-pentylbenzo[d][1,3]benzodioxepine.
| Compound Name | 6-deuterio-6-pentylbenzo[d][1,3]benzodioxepine |
|---|---|
| PubChem CID | 102077062 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 6-deuterio-6-pentylbenzo[d][1,3]benzodioxepine |
| SMILES | [2H]C1(CCCCC)Oc2ccccc2-c2ccccc2O1 |
| InChI | InChI=1S/C18H20O2/c1-2-3-4-13-18-19-16-11-7-5-9-14(16)15-10-6-8-12-17(15)20-18/h5-12,18H,2-4,13H2,1H3/i18D |
| InChIKey | TVJABODBLVWHHP-VAAKKRCDSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|