About 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one
3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one (PubChem CID 126989870) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one.
Molecular Properties
| Compound Name | 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one |
| PubChem CID | 126989870 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one |
| SMILES | CCCC1(C)NC(C)C(=O)N1CC |
| InChI | InChI=1S/C10H20N2O/c1-5-7-10(4)11-8(3)9(13)12(10)6-2/h8,11H,5-7H2,1-4H3 |
| InChIKey | KZQVTRQCFXJOHB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one?
The IUPAC name of 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one (CID 126989870) is 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one.
What is the SMILES notation for 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one?
The canonical SMILES for 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one is CCCC1(C)NC(C)C(=O)N1CC.
What is the InChIKey of 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one?
The InChIKey is KZQVTRQCFXJOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-5-7-10(4)11-8(3)9(13)12(10)6-2/h8,11H,5-7H2,1-4H3.
What are the key properties of 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one?
3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one has a molecular weight of 184.28 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,5-dimethyl-2-propylimidazolidin-4-one is sourced from PubChem (CID 126989870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).