C7H15N — CID 123992321
2,3-dimethyl-2-propylaziridine (PubChem CID 123992321) has the molecular formula C7H15N and a molecular weight of 113.20 g/mol. Its IUPAC name is 2,3-dimethyl-2-propylaziridine.
| Compound Name | 2,3-dimethyl-2-propylaziridine |
|---|---|
| PubChem CID | 123992321 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | 2,3-dimethyl-2-propylaziridine |
| SMILES | CCCC1(C)NC1C |
| InChI | InChI=1S/C7H15N/c1-4-5-7(3)6(2)8-7/h6,8H,4-5H2,1-3H3 |
| InChIKey | YQLCGZJKRSWOOK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|