C8H16O — CID 89191195
2,3-dimethyl-2-propyloxetane (PubChem CID 89191195) has the molecular formula C8H16O and a molecular weight of 128.22 g/mol. Its IUPAC name is 2,3-dimethyl-2-propyloxetane.
| Compound Name | 2,3-dimethyl-2-propyloxetane |
|---|---|
| PubChem CID | 89191195 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 2,3-dimethyl-2-propyloxetane |
| SMILES | CCCC1(C)OCC1C |
| InChI | InChI=1S/C8H16O/c1-4-5-8(3)7(2)6-9-8/h7H,4-6H2,1-3H3 |
| InChIKey | IFFYWIQLWPZQAJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |