C7H10FIO2 — CID 101459127
(4R,5S)-4-fluoro-5-(iodomethyl)-3,3-dimethyloxolan-2-one (PubChem CID 101459127) has the molecular formula C7H10FIO2 and a molecular weight of 272.06 g/mol. Its IUPAC name is (4R,5S)-4-fluoro-5-(iodomethyl)-3,3-dimethyloxolan-2-one.
| Compound Name | (4R,5S)-4-fluoro-5-(iodomethyl)-3,3-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 101459127 |
| Molecular Formula | C7H10FIO2 |
| Molecular Weight | 272.06 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | (4R,5S)-4-fluoro-5-(iodomethyl)-3,3-dimethyloxolan-2-one |
| SMILES | CC1(C)C(=O)O[C@H](CI)[C@@H]1F |
| InChI | InChI=1S/C7H10FIO2/c1-7(2)5(8)4(3-9)11-6(7)10/h4-5H,3H2,1-2H3/t4-,5+/m1/s1 |
| InChIKey | SLCBXLLGMCSHFG-UHNVWZDZSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.06 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|