C8H13IO2 — CID 10849462
(3S,4R,5R)-4-ethyl-5-(iodomethyl)-3-methyloxolan-2-one (PubChem CID 10849462) has the molecular formula C8H13IO2 and a molecular weight of 268.09 g/mol. Its IUPAC name is (3S,4R,5R)-4-ethyl-5-(iodomethyl)-3-methyloxolan-2-one.
| Compound Name | (3S,4R,5R)-4-ethyl-5-(iodomethyl)-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 10849462 |
| Molecular Formula | C8H13IO2 |
| Molecular Weight | 268.09 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | (3S,4R,5R)-4-ethyl-5-(iodomethyl)-3-methyloxolan-2-one |
| SMILES | CC[C@H]1[C@H](CI)OC(=O)[C@H]1C |
| InChI | InChI=1S/C8H13IO2/c1-3-6-5(2)8(10)11-7(6)4-9/h5-7H,3-4H2,1-2H3/t5-,6+,7-/m0/s1 |
| InChIKey | RBWJIUAWIBJCIK-XVMARJQXSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.09 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|