C9H14O3 — CID 53348666
(3R,5S,6R)-6-ethyl-3,5-dimethyloxane-2,4-dione (PubChem CID 53348666) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (3R,5S,6R)-6-ethyl-3,5-dimethyloxane-2,4-dione.
| Compound Name | (3R,5S,6R)-6-ethyl-3,5-dimethyloxane-2,4-dione |
|---|---|
| PubChem CID | 53348666 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (3R,5S,6R)-6-ethyl-3,5-dimethyloxane-2,4-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H]1C |
| InChI | InChI=1S/C9H14O3/c1-4-7-5(2)8(10)6(3)9(11)12-7/h5-7H,4H2,1-3H3/t5-,6+,7+/m0/s1 |
| InChIKey | WENGDWLJTQGDNF-RRKCRQDMSA-N |
| XLogP | 1.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|