C7H10O3 — CID 77476558
5-ethyl-3-methyloxolane-2,4-dione (PubChem CID 77476558) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is 5-ethyl-3-methyloxolane-2,4-dione.
| Compound Name | 5-ethyl-3-methyloxolane-2,4-dione |
|---|---|
| PubChem CID | 77476558 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 5-ethyl-3-methyloxolane-2,4-dione |
| SMILES | CCC1OC(=O)C(C)C1=O |
| InChI | InChI=1S/C7H10O3/c1-3-5-6(8)4(2)7(9)10-5/h4-5H,3H2,1-2H3 |
| InChIKey | MZLNWMIFBPDIEH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|