C23H40O6 — CID 142203936
(1R,12R,17S)-3-ethyl-7-hydroxy-6,8,10,12,15,15,17-heptamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecane-2,5-dione (PubChem CID 142203936) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (1R,12R,17S)-3-ethyl-7-hydroxy-6,8,10,12,15,15,17-heptamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecane-2,5-dione.
| Compound Name | (1R,12R,17S)-3-ethyl-7-hydroxy-6,8,10,12,15,15,17-heptamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecane-2,5-dione |
|---|---|
| PubChem CID | 142203936 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (1R,12R,17S)-3-ethyl-7-hydroxy-6,8,10,12,15,15,17-heptamethyl-4,14,16-trioxabicyclo[11.3.1]heptadecane-2,5-dione |
| SMILES | CCC1OC(=O)C(C)C(O)C(C)CC(C)C[C@@H](C)C2OC(C)(C)O[C@@H](C1=O)[C@H]2C |
| InChI | InChI=1S/C23H40O6/c1-9-17-19(25)21-16(6)20(28-23(7,8)29-21)14(4)11-12(2)10-13(3)18(24)15(5)22(26)27-17/h12-18,20-21,24H,9-11H2,1-8H3/t12?,13?,14-,15?,16+,17?,18?,20?,21-/m1/s1 |
| InChIKey | BRYQKKAASUEKKW-YXPROISUSA-N |
| XLogP | 3.73 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |