C24H44O7 — CID 101197490
16-ethyl-4,6,7,14-tetrahydroxy-3,5,7,9,11,13,15-heptamethyl-oxacyclohexadecane-2,12-dione (PubChem CID 101197490) has the molecular formula C24H44O7 and a molecular weight of 444.61 g/mol. Its IUPAC name is 16-ethyl-4,6,7,14-tetrahydroxy-3,5,7,9,11,13,15-heptamethyl-oxacyclohexadecane-2,12-dione.
| Compound Name | 16-ethyl-4,6,7,14-tetrahydroxy-3,5,7,9,11,13,15-heptamethyl-oxacyclohexadecane-2,12-dione |
|---|---|
| PubChem CID | 101197490 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 16-ethyl-4,6,7,14-tetrahydroxy-3,5,7,9,11,13,15-heptamethyl-oxacyclohexadecane-2,12-dione |
| SMILES | CCC1OC(=O)C(C)C(O)C(C)C(O)C(C)(O)CC(C)CC(C)C(=O)C(C)C(O)C1C |
| InChI | InChI=1S/C24H44O7/c1-9-18-14(4)20(26)15(5)19(25)13(3)10-12(2)11-24(8,30)22(28)16(6)21(27)17(7)23(29)31-18/h12-18,20-22,26-28,30H,9-11H2,1-8H3 |
| InChIKey | QPEVMUKJSXGUHI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |