C20H35ClO6 — CID 20826742
14-(chloromethyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 20826742) has the molecular formula C20H35ClO6 and a molecular weight of 406.95 g/mol. Its IUPAC name is 14-(chloromethyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | 14-(chloromethyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 20826742 |
| Molecular Formula | C20H35ClO6 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 14-(chloromethyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CC1CC(C)C(O)C(C)C(O)C(C)C(=O)OC(CCl)C(C)C(O)C(C)C1=O |
| InChI | InChI=1S/C20H35ClO6/c1-9-7-10(2)17(23)13(5)19(25)14(6)20(26)27-15(8-21)11(3)18(24)12(4)16(9)22/h9-15,17-19,23-25H,7-8H2,1-6H3 |
| InChIKey | LJSOZDWCIQXGAV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|