C22H39N3O6 — CID 59106540
(3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-(3-azidopropyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 59106540) has the molecular formula C22H39N3O6 and a molecular weight of 441.57 g/mol. Its IUPAC name is (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-(3-azidopropyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-(3-azidopropyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 59106540 |
| Molecular Formula | C22H39N3O6 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | (3R,4S,5R,6S,7S,9R,11R,12S,13R,14R)-14-(3-azidopropyl)-4,6,12-trihydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](CCCN=[N+]=[N-])OC(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C22H39N3O6/c1-11-10-12(2)19(27)15(5)21(29)16(6)22(30)31-17(8-7-9-24-25-23)13(3)20(28)14(4)18(11)26/h11-17,19-21,27-29H,7-10H2,1-6H3/t11-,12+,13+,14+,15-,16-,17-,19+,20+,21+/m1/s1 |
| InChIKey | VXGNGIRPGROPDP-JKNGSDSYSA-N |
| XLogP | 2.86 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|