C20H38O5 — CID 59895535
(3R,4S,5R,7S,11S,12R,13R,14R)-14-ethyl-4,10,12-trihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecan-2-one (PubChem CID 59895535) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is (3R,4S,5R,7S,11S,12R,13R,14R)-14-ethyl-4,10,12-trihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecan-2-one.
| Compound Name | (3R,4S,5R,7S,11S,12R,13R,14R)-14-ethyl-4,10,12-trihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 59895535 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (3R,4S,5R,7S,11S,12R,13R,14R)-14-ethyl-4,10,12-trihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@H](C)C[C@@H](C)CCC(O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C20H38O5/c1-7-17-14(5)19(23)13(4)16(21)9-8-11(2)10-12(3)18(22)15(6)20(24)25-17/h11-19,21-23H,7-10H2,1-6H3/t11-,12+,13-,14-,15+,16?,17+,18-,19+/m0/s1 |
| InChIKey | AZBDDJLXBIRBCI-JHEUPAGVSA-N |
| XLogP | 2.76 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |