C20H34O5 — CID 59895520
(3R,5R,6S,7S,11R,13R,14R)-14-ethyl-6-hydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione (PubChem CID 59895520) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (3R,5R,6S,7S,11R,13R,14R)-14-ethyl-6-hydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione.
| Compound Name | (3R,5R,6S,7S,11R,13R,14R)-14-ethyl-6-hydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione |
|---|---|
| PubChem CID | 59895520 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (3R,5R,6S,7S,11R,13R,14R)-14-ethyl-6-hydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCC(=O)[C@H](C)C[C@H]1C |
| InChI | InChI=1S/C20H34O5/c1-7-17-13(4)10-12(3)16(21)9-8-11(2)18(22)14(5)19(23)15(6)20(24)25-17/h11-15,17-18,22H,7-10H2,1-6H3/t11-,12+,13+,14+,15+,17+,18-/m0/s1 |
| InChIKey | XEDFSNBFQIXSHV-LPBVGCFOSA-N |
| XLogP | 3.17 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|