C23H40O7 — CID 177411529
(3R,5S,7R,11R)-4-[(2S,4R,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-12-ethyl-3,5,7,11-tetramethyl-oxacyclododecane-2,8-dione (PubChem CID 177411529) has the molecular formula C23H40O7 and a molecular weight of 428.57 g/mol. Its IUPAC name is (3R,5S,7R,11R)-4-[(2S,4R,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-12-ethyl-3,5,7,11-tetramethyl-oxacyclododecane-2,8-dione.
| Compound Name | (3R,5S,7R,11R)-4-[(2S,4R,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-12-ethyl-3,5,7,11-tetramethyl-oxacyclododecane-2,8-dione |
|---|---|
| PubChem CID | 177411529 |
| Molecular Formula | C23H40O7 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (3R,5S,7R,11R)-4-[(2S,4R,5R,6S)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-12-ethyl-3,5,7,11-tetramethyl-oxacyclododecane-2,8-dione |
| SMILES | CCC1OC(=O)[C@H](C)C(O[C@@H]2C[C@@H](O)[C@@H](O)[C@H](C)O2)[C@@H](C)C[C@@H](C)C(=O)CC[C@H]1C |
| InChI | InChI=1S/C23H40O7/c1-7-19-12(2)8-9-17(24)13(3)10-14(4)22(15(5)23(27)29-19)30-20-11-18(25)21(26)16(6)28-20/h12-16,18-22,25-26H,7-11H2,1-6H3/t12-,13-,14+,15-,16+,18-,19?,20-,21+,22?/m1/s1 |
| InChIKey | SQRZUVMGHDJWDV-GGWFKDATSA-N |
| XLogP | 2.85 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |