C20H34O6 — CID 21343786
14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione (PubChem CID 21343786) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is 14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione.
| Compound Name | 14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione |
|---|---|
| PubChem CID | 21343786 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 14-ethyl-6,12-dihydroxy-3,5,7,11,13-pentamethyl-oxacyclotetradecane-2,4,10-trione |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)C(O)C(C)CCC(=O)C(C)C(O)C1C |
| InChI | InChI=1S/C20H34O6/c1-7-16-12(4)18(23)11(3)15(21)9-8-10(2)17(22)13(5)19(24)14(6)20(25)26-16/h10-14,16-18,22-23H,7-9H2,1-6H3 |
| InChIKey | LZFSGOVFNHRIMW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|