C22H38O4 — CID 21343770
(3E)-12-hydroxy-3,5,6,7,11,13-hexamethyl-14-propyl-1-oxacyclotetradec-3-ene-2,10-dione (PubChem CID 21343770) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (3E)-12-hydroxy-3,5,6,7,11,13-hexamethyl-14-propyl-1-oxacyclotetradec-3-ene-2,10-dione.
| Compound Name | (3E)-12-hydroxy-3,5,6,7,11,13-hexamethyl-14-propyl-1-oxacyclotetradec-3-ene-2,10-dione |
|---|---|
| PubChem CID | 21343770 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (3E)-12-hydroxy-3,5,6,7,11,13-hexamethyl-14-propyl-1-oxacyclotetradec-3-ene-2,10-dione |
| SMILES | CCCC1OC(=O)/C(C)=C/C(C)C(C)C(C)CCC(=O)C(C)C(O)C1C |
| InChI | InChI=1S/C22H38O4/c1-8-9-20-18(7)21(24)17(6)19(23)11-10-13(2)16(5)14(3)12-15(4)22(25)26-20/h12-14,16-18,20-21,24H,8-11H2,1-7H3/b15-12+ |
| InChIKey | KYKPMFUNRBMXPV-NTCAYCPXSA-N |
| XLogP | 4.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |