C28H51NO8 — CID 59986244
(3R,4S,6R,7S,9R,11R,12S,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 59986244) has the molecular formula C28H51NO8 and a molecular weight of 529.72 g/mol. Its IUPAC name is (3R,4S,6R,7S,9R,11R,12S,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,6R,7S,9R,11R,12S,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 59986244 |
| Molecular Formula | C28H51NO8 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.36 |
| IUPAC Name | (3R,4S,6R,7S,9R,11R,12S,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)C[C@@H](OC2OC(C)CC(N(C)C)C2O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C28H51NO8/c1-10-22-18(6)25(32)19(7)24(31)15(3)11-14(2)23(13-21(30)17(5)27(34)36-22)37-28-26(33)20(29(8)9)12-16(4)35-28/h14-23,25-26,28,30,32-33H,10-13H2,1-9H3/t14-,15+,16?,17+,18-,19-,20?,21-,22+,23+,25-,26?,28?/m0/s1 |
| InChIKey | MNDIDOPKNLOMHP-DMONGBEFSA-N |
| XLogP | 2.38 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |