C26H47NO8 — CID 59986237
(4S,6R,7S,9R,12R,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-7,9,13-trimethyl-oxacyclotetradecane-2,10-dione (PubChem CID 59986237) has the molecular formula C26H47NO8 and a molecular weight of 501.66 g/mol. Its IUPAC name is (4S,6R,7S,9R,12R,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-7,9,13-trimethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (4S,6R,7S,9R,12R,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-7,9,13-trimethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 59986237 |
| Molecular Formula | C26H47NO8 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.33 |
| IUPAC Name | (4S,6R,7S,9R,12R,13R,14R)-6-[4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-4,12-dihydroxy-7,9,13-trimethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CC[C@H]1OC(=O)C[C@@H](O)C[C@@H](OC2OC(C)CC(N(C)C)C2O)[C@@H](C)C[C@@H](C)C(=O)C[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C26H47NO8/c1-8-22-17(5)21(30)13-20(29)14(2)9-15(3)23(11-18(28)12-24(31)34-22)35-26-25(32)19(27(6)7)10-16(4)33-26/h14-19,21-23,25-26,28,30,32H,8-13H2,1-7H3/t14-,15+,16?,17-,18+,19?,21-,22-,23-,25?,26?/m1/s1 |
| InChIKey | FNGQEZHHBCCPCL-ROCOVLFWSA-N |
| XLogP | 1.89 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |