C28H40O5 — CID 21301469
4,12-dihydroxy-3,5,6,7,9,11,13-heptamethyl-14-(2-phenylethynyl)-oxacyclotetradecane-2,10-dione (PubChem CID 21301469) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is 4,12-dihydroxy-3,5,6,7,9,11,13-heptamethyl-14-(2-phenylethynyl)-oxacyclotetradecane-2,10-dione.
| Compound Name | 4,12-dihydroxy-3,5,6,7,9,11,13-heptamethyl-14-(2-phenylethynyl)-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 21301469 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 4,12-dihydroxy-3,5,6,7,9,11,13-heptamethyl-14-(2-phenylethynyl)-oxacyclotetradecane-2,10-dione |
| SMILES | CC1CC(C)C(C)C(C)C(O)C(C)C(=O)OC(C#Cc2ccccc2)C(C)C(O)C(C)C1=O |
| InChI | InChI=1S/C28H40O5/c1-16-15-17(2)25(29)21(6)27(31)20(5)24(14-13-23-11-9-8-10-12-23)33-28(32)22(7)26(30)19(4)18(16)3/h8-12,16-22,24,26-27,30-31H,15H2,1-7H3 |
| InChIKey | SLLGKTGQLJKQRT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|