C22H36O6 — CID 59923976
(1R,4R,5S,6R,7S,8S,10R,12R,13S,14R)-5,7,13-trihydroxy-4,6,8,10,12-pentamethyl-2-oxabicyclo[12.4.0]octadec-15-ene-3,11-dione (PubChem CID 59923976) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (1R,4R,5S,6R,7S,8S,10R,12R,13S,14R)-5,7,13-trihydroxy-4,6,8,10,12-pentamethyl-2-oxabicyclo[12.4.0]octadec-15-ene-3,11-dione.
| Compound Name | (1R,4R,5S,6R,7S,8S,10R,12R,13S,14R)-5,7,13-trihydroxy-4,6,8,10,12-pentamethyl-2-oxabicyclo[12.4.0]octadec-15-ene-3,11-dione |
|---|---|
| PubChem CID | 59923976 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (1R,4R,5S,6R,7S,8S,10R,12R,13S,14R)-5,7,13-trihydroxy-4,6,8,10,12-pentamethyl-2-oxabicyclo[12.4.0]octadec-15-ene-3,11-dione |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]2C=CCC[C@H]2OC(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C22H36O6/c1-11-10-12(2)19(24)14(4)21(26)16-8-6-7-9-17(16)28-22(27)15(5)20(25)13(3)18(11)23/h6,8,11-18,20-21,23,25-26H,7,9-10H2,1-5H3/t11-,12+,13+,14-,15+,16-,17+,18-,20-,21+/m0/s1 |
| InChIKey | VWNCCBLMKGWLCY-DEPSYMKBSA-N |
| XLogP | 2.10 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|