C17H30O5 — CID 23397910
4,6-dihydroxy-3,5,7,9,11,12-hexamethyl-oxacyclododecane-2,10-dione (PubChem CID 23397910) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 4,6-dihydroxy-3,5,7,9,11,12-hexamethyl-oxacyclododecane-2,10-dione.
| Compound Name | 4,6-dihydroxy-3,5,7,9,11,12-hexamethyl-oxacyclododecane-2,10-dione |
|---|---|
| PubChem CID | 23397910 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4,6-dihydroxy-3,5,7,9,11,12-hexamethyl-oxacyclododecane-2,10-dione |
| SMILES | CC1CC(C)C(O)C(C)C(O)C(C)C(=O)OC(C)C(C)C1=O |
| InChI | InChI=1S/C17H30O5/c1-8-7-9(2)15(19)11(4)16(20)12(5)17(21)22-13(6)10(3)14(8)18/h8-13,15-16,19-20H,7H2,1-6H3 |
| InChIKey | BWMGFOWLIVGAPZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |