C8H14O4 — CID 91061020
(3S,4R,6R)-4,6-dihydroxy-3,7-dimethyloxepan-2-one (PubChem CID 91061020) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (3S,4R,6R)-4,6-dihydroxy-3,7-dimethyloxepan-2-one.
| Compound Name | (3S,4R,6R)-4,6-dihydroxy-3,7-dimethyloxepan-2-one |
|---|---|
| PubChem CID | 91061020 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (3S,4R,6R)-4,6-dihydroxy-3,7-dimethyloxepan-2-one |
| SMILES | CC1OC(=O)[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C8H14O4/c1-4-6(9)3-7(10)5(2)12-8(4)11/h4-7,9-10H,3H2,1-2H3/t4-,5?,6+,7+/m0/s1 |
| InChIKey | ARRJWYQYZDYKMK-LMMQKCLSSA-N |
| XLogP | -0.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |