C6H10O4 — CID 129171742
(3S,6S)-5-hydroxy-3,6-dimethyl-1,4-dioxan-2-one (PubChem CID 129171742) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (3S,6S)-5-hydroxy-3,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (3S,6S)-5-hydroxy-3,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 129171742 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (3S,6S)-5-hydroxy-3,6-dimethyl-1,4-dioxan-2-one |
| SMILES | C[C@@H]1OC(O)[C@H](C)OC1=O |
| InChI | InChI=1S/C6H10O4/c1-3-5(7)10-4(2)6(8)9-3/h3-5,7H,1-2H3/t3-,4-,5?/m0/s1 |
| InChIKey | IBWZPQFFDQZVOR-QRHDOFTISA-N |
| XLogP | -0.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |