C6H10O3 — CID 130927474
(3S,4R,5R)-3-hydroxy-4,5-dimethyloxolan-2-one (PubChem CID 130927474) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (3S,4R,5R)-3-hydroxy-4,5-dimethyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-hydroxy-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 130927474 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (3S,4R,5R)-3-hydroxy-4,5-dimethyloxolan-2-one |
| SMILES | C[C@@H]1[C@H](O)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C6H10O3/c1-3-4(2)9-6(8)5(3)7/h3-5,7H,1-2H3/t3-,4+,5-/m0/s1 |
| InChIKey | OCIRUFLKJHXXGD-LMVFSUKVSA-N |
| XLogP | -0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |