C5H6O2 — CID 100946634
CID 100946634 (PubChem CID 100946634) has the molecular formula C5H6O2 and a molecular weight of 98.10 g/mol.
| Compound Name | CID 100946634 |
|---|---|
| PubChem CID | 100946634 |
| Molecular Formula | C5H6O2 |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 98.04 |
| IUPAC Name | — |
| SMILES | [CH]C1C(=O)OC1C |
| InChI | InChI=1S/C5H6O2/c1-3-4(2)7-5(3)6/h1,3-4H,2H3 |
| InChIKey | WNTIJPOEECFWHC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|