C6H11NO4S — CID 89334107
(2S,3R,4S)-2,3-dimethyl-5-oxo-4-(sulfinoamino)oxolane (PubChem CID 89334107) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is (2S,3R,4S)-2,3-dimethyl-5-oxo-4-(sulfinoamino)oxolane.
| Compound Name | (2S,3R,4S)-2,3-dimethyl-5-oxo-4-(sulfinoamino)oxolane |
|---|---|
| PubChem CID | 89334107 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | (2S,3R,4S)-2,3-dimethyl-5-oxo-4-(sulfinoamino)oxolane |
| SMILES | C[C@H]1[C@H](C)OC(=O)[C@H]1NS(=O)O |
| InChI | InChI=1S/C6H11NO4S/c1-3-4(2)11-6(8)5(3)7-12(9)10/h3-5,7H,1-2H3,(H,9,10)/t3-,4-,5-/m0/s1 |
| InChIKey | SLOGCBQAJZIOPD-YUPRTTJUSA-N |
| XLogP | -0.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|