C20H36O8 — CID 10216217
(3R,4S,5R,6S,7S,9S,11R,12S,13R,14R)-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 10216217) has the molecular formula C20H36O8 and a molecular weight of 404.50 g/mol. Its IUPAC name is (3R,4S,5R,6S,7S,9S,11R,12S,13R,14R)-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5R,6S,7S,9S,11R,12S,13R,14R)-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 10216217 |
| Molecular Formula | C20H36O8 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (3R,4S,5R,6S,7S,9S,11R,12S,13R,14R)-4,6,9,12-tetrahydroxy-9-(hydroxymethyl)-3,5,7,11,13,14-hexamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | C[C@@H]1[C@@H](O)[C@@H](C)C[C@](O)(CO)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H](C)OC(=O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C20H36O8/c1-9-7-20(27,8-21)18(25)12(4)16(23)10(2)14(6)28-19(26)13(5)17(24)11(3)15(9)22/h9-17,21-24,27H,7-8H2,1-6H3/t9-,10-,11+,12+,13+,14+,15-,16-,17-,20-/m0/s1 |
| InChIKey | PPWDUQXVEZPUFH-CHHYGBEXSA-N |
| XLogP | -0.12 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |