C21H39NO8 — CID 125029696
(3R,4R,5S,6S,7R,9S,10Z,11S,12S,13R,14S)-14-ethyl-4,6,7,12,13-pentahydroxy-10-hydroxyimino-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one (PubChem CID 125029696) has the molecular formula C21H39NO8 and a molecular weight of 433.54 g/mol. Its IUPAC name is (3R,4R,5S,6S,7R,9S,10Z,11S,12S,13R,14S)-14-ethyl-4,6,7,12,13-pentahydroxy-10-hydroxyimino-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one.
| Compound Name | (3R,4R,5S,6S,7R,9S,10Z,11S,12S,13R,14S)-14-ethyl-4,6,7,12,13-pentahydroxy-10-hydroxyimino-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 125029696 |
| Molecular Formula | C21H39NO8 |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | (3R,4R,5S,6S,7R,9S,10Z,11S,12S,13R,14S)-14-ethyl-4,6,7,12,13-pentahydroxy-10-hydroxyimino-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
| SMILES | CC[C@@H]1OC(=O)[C@H](C)[C@H](O)[C@H](C)[C@H](O)[C@](C)(O)C[C@H](C)/C(=N/O)[C@H](C)[C@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C21H39NO8/c1-8-14-21(7,28)18(25)11(3)15(22-29)10(2)9-20(6,27)17(24)12(4)16(23)13(5)19(26)30-14/h10-14,16-18,23-25,27-29H,8-9H2,1-7H3/b22-15-/t10-,11-,12-,13+,14-,16+,17-,18-,20+,21-/m0/s1 |
| InChIKey | QGEFLDXKROJGHX-URPWIZGWSA-N |
| XLogP | 0.67 |
| TPSA | 160.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|