C26H49NO6 — CID 145467945
(4S,5R,7R,9R,13S,14R)-14-ethyl-12,13-dihydroxy-4,7-dimethoxy-3,5,7,9,11,13-hexamethyl-10-propylimino-oxacyclotetradecan-2-one (PubChem CID 145467945) has the molecular formula C26H49NO6 and a molecular weight of 471.68 g/mol. Its IUPAC name is (4S,5R,7R,9R,13S,14R)-14-ethyl-12,13-dihydroxy-4,7-dimethoxy-3,5,7,9,11,13-hexamethyl-10-propylimino-oxacyclotetradecan-2-one.
| Compound Name | (4S,5R,7R,9R,13S,14R)-14-ethyl-12,13-dihydroxy-4,7-dimethoxy-3,5,7,9,11,13-hexamethyl-10-propylimino-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 145467945 |
| Molecular Formula | C26H49NO6 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.36 |
| IUPAC Name | (4S,5R,7R,9R,13S,14R)-14-ethyl-12,13-dihydroxy-4,7-dimethoxy-3,5,7,9,11,13-hexamethyl-10-propylimino-oxacyclotetradecan-2-one |
| SMILES | CCC/N=C1\C(C)C(O)[C@](C)(O)[C@@H](CC)OC(=O)C(C)[C@@H](OC)[C@H](C)C[C@](C)(OC)C[C@H]1C |
| InChI | InChI=1S/C26H49NO6/c1-11-13-27-21-16(3)14-25(7,32-10)15-17(4)22(31-9)19(6)24(29)33-20(12-2)26(8,30)23(28)18(21)5/h16-20,22-23,28,30H,11-15H2,1-10H3/b27-21-/t16-,17-,18?,19?,20-,22+,23?,25-,26-/m1/s1 |
| InChIKey | MWSFKZPXOIMADX-FDJWGNAQSA-N |
| XLogP | 4.03 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|