C25H43NO7 — CID 143299545
(1R,10R,16S,17E,18R)-3-ethyl-2,7-dihydroxy-17-hydroxyimino-2,6,8,10,16,18-hexamethyl-13-methylidene-4,11,15-trioxabicyclo[8.5.4]nonadecan-5-one (PubChem CID 143299545) has the molecular formula C25H43NO7 and a molecular weight of 469.62 g/mol. Its IUPAC name is (1R,10R,16S,17E,18R)-3-ethyl-2,7-dihydroxy-17-hydroxyimino-2,6,8,10,16,18-hexamethyl-13-methylidene-4,11,15-trioxabicyclo[8.5.4]nonadecan-5-one.
| Compound Name | (1R,10R,16S,17E,18R)-3-ethyl-2,7-dihydroxy-17-hydroxyimino-2,6,8,10,16,18-hexamethyl-13-methylidene-4,11,15-trioxabicyclo[8.5.4]nonadecan-5-one |
|---|---|
| PubChem CID | 143299545 |
| Molecular Formula | C25H43NO7 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | (1R,10R,16S,17E,18R)-3-ethyl-2,7-dihydroxy-17-hydroxyimino-2,6,8,10,16,18-hexamethyl-13-methylidene-4,11,15-trioxabicyclo[8.5.4]nonadecan-5-one |
| SMILES | C=C1CO[C@@H]2[C@@H](C)/C(=N/O)[C@H](C)C[C@](C)(CC(C)C(O)C(C)C(=O)OC(CC)C2(C)O)OC1 |
| InChI | InChI=1S/C25H43NO7/c1-9-19-25(8,29)22-17(5)20(26-30)15(3)10-24(7,32-13-14(2)12-31-22)11-16(4)21(27)18(6)23(28)33-19/h15-19,21-22,27,29-30H,2,9-13H2,1,3-8H3/b26-20+/t15-,16?,17+,18?,19?,21?,22-,24-,25?/m1/s1 |
| InChIKey | XNVLUSPAAFELGU-AWFBSDKESA-N |
| XLogP | 3.32 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|