C25H45NO7 — CID 145467610
(3R,5R,7R,9R,11S,13S,14R)-14-ethyl-12,13-dihydroxy-7-methoxy-10-(2-methoxyethylimino)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione (PubChem CID 145467610) has the molecular formula C25H45NO7 and a molecular weight of 471.64 g/mol. Its IUPAC name is (3R,5R,7R,9R,11S,13S,14R)-14-ethyl-12,13-dihydroxy-7-methoxy-10-(2-methoxyethylimino)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione.
| Compound Name | (3R,5R,7R,9R,11S,13S,14R)-14-ethyl-12,13-dihydroxy-7-methoxy-10-(2-methoxyethylimino)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione |
|---|---|
| PubChem CID | 145467610 |
| Molecular Formula | C25H45NO7 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | (3R,5R,7R,9R,11S,13S,14R)-14-ethyl-12,13-dihydroxy-7-methoxy-10-(2-methoxyethylimino)-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,4-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)C[C@](C)(OC)C[C@@H](C)/C(=N/CCOC)[C@H](C)C(O)[C@]1(C)O |
| InChI | InChI=1S/C25H45NO7/c1-10-19-25(7,30)22(28)17(4)20(26-11-12-31-8)15(2)13-24(6,32-9)14-16(3)21(27)18(5)23(29)33-19/h15-19,22,28,30H,10-14H2,1-9H3/b26-20-/t15-,16-,17+,18-,19-,22?,24-,25-/m1/s1 |
| InChIKey | WHIHNZUZBLNTMS-ZJKWWFJQSA-N |
| XLogP | 2.82 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|