C23H41NO6 — CID 143101141
(3R,7R,9R,11S,12R,13S,14R)-14-ethyl-12,13-dihydroxy-10-imino-7-methoxy-3,6,6,7,9,11,13-heptamethyl-oxacyclotetradecane-2,4-dione (PubChem CID 143101141) has the molecular formula C23H41NO6 and a molecular weight of 427.58 g/mol. Its IUPAC name is (3R,7R,9R,11S,12R,13S,14R)-14-ethyl-12,13-dihydroxy-10-imino-7-methoxy-3,6,6,7,9,11,13-heptamethyl-oxacyclotetradecane-2,4-dione.
| Compound Name | (3R,7R,9R,11S,12R,13S,14R)-14-ethyl-12,13-dihydroxy-10-imino-7-methoxy-3,6,6,7,9,11,13-heptamethyl-oxacyclotetradecane-2,4-dione |
|---|---|
| PubChem CID | 143101141 |
| Molecular Formula | C23H41NO6 |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | (3R,7R,9R,11S,12R,13S,14R)-14-ethyl-12,13-dihydroxy-10-imino-7-methoxy-3,6,6,7,9,11,13-heptamethyl-oxacyclotetradecane-2,4-dione |
| SMILES | [H]/N=C1/[C@H](C)C[C@@](C)(OC)C(C)(C)CC(=O)[C@@H](C)C(=O)O[C@H](CC)[C@@](C)(O)[C@H](O)[C@H]1C |
| InChI | InChI=1S/C23H41NO6/c1-10-17-23(8,28)19(26)15(4)18(24)13(2)11-22(7,29-9)21(5,6)12-16(25)14(3)20(27)30-17/h13-15,17,19,24,26,28H,10-12H2,1-9H3/b24-18-/t13-,14-,15+,17-,19-,22-,23-/m1/s1 |
| InChIKey | OHJHQOYYXMJSGY-DYHBMMRKSA-N |
| XLogP | 3.14 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|