C25H49NO4 — CID 142879167
(2R,3S,4R,5R,8R,11R,12S,13S,14R)-2-ethyl-3,4-dihydroxy-3,5,6,8,10,10,11,12,13,14-decamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 142879167) has the molecular formula C25H49NO4 and a molecular weight of 427.67 g/mol. Its IUPAC name is (2R,3S,4R,5R,8R,11R,12S,13S,14R)-2-ethyl-3,4-dihydroxy-3,5,6,8,10,10,11,12,13,14-decamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,3S,4R,5R,8R,11R,12S,13S,14R)-2-ethyl-3,4-dihydroxy-3,5,6,8,10,10,11,12,13,14-decamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 142879167 |
| Molecular Formula | C25H49NO4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | (2R,3S,4R,5R,8R,11R,12S,13S,14R)-2-ethyl-3,4-dihydroxy-3,5,6,8,10,10,11,12,13,14-decamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](C)[C@H](C)[C@@H](C)C(C)(C)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C25H49NO4/c1-12-21-25(10,29)22(27)20(7)26(11)14-15(2)13-24(8,9)19(6)17(4)16(3)18(5)23(28)30-21/h15-22,27,29H,12-14H2,1-11H3/t15-,16+,17+,18-,19-,20-,21-,22-,25-/m1/s1 |
| InChIKey | SOPHXJDIVZKWSW-KDHXLJQOSA-N |
| XLogP | 4.35 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |