C28H53NO8 — CID 71206851
(2R,3S,4R,5R,8R,10S,13S,14R)-2-ethyl-3,4,10-trihydroxy-13-[(2S,4S,6S)-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 71206851) has the molecular formula C28H53NO8 and a molecular weight of 531.73 g/mol. Its IUPAC name is (2R,3S,4R,5R,8R,10S,13S,14R)-2-ethyl-3,4,10-trihydroxy-13-[(2S,4S,6S)-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,3S,4R,5R,8R,10S,13S,14R)-2-ethyl-3,4,10-trihydroxy-13-[(2S,4S,6S)-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 71206851 |
| Molecular Formula | C28H53NO8 |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.38 |
| IUPAC Name | (2R,3S,4R,5R,8R,10S,13S,14R)-2-ethyl-3,4,10-trihydroxy-13-[(2S,4S,6S)-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)C[C@H](C)O2)CC[C@H](O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C28H53NO8/c1-10-23-28(7,33)25(31)20(5)29(8)16-17(2)13-21(30)11-12-22(19(4)26(32)37-23)36-24-15-27(6,34-9)14-18(3)35-24/h17-25,30-31,33H,10-16H2,1-9H3/t17-,18+,19-,20-,21+,22+,23-,24+,25-,27+,28-/m1/s1 |
| InChIKey | UQFKHRXSCPLIGL-IUELOQSRSA-N |
| XLogP | 2.87 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |