C24H45NO9 — CID 129313037
(3R,7R,12S)-3,4,9-trihydroxy-12-[(2R,4R,5S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,13-tetramethyl-1-oxa-5-azacyclotetradecan-14-one (PubChem CID 129313037) has the molecular formula C24H45NO9 and a molecular weight of 491.62 g/mol. Its IUPAC name is (3R,7R,12S)-3,4,9-trihydroxy-12-[(2R,4R,5S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,13-tetramethyl-1-oxa-5-azacyclotetradecan-14-one.
| Compound Name | (3R,7R,12S)-3,4,9-trihydroxy-12-[(2R,4R,5S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,13-tetramethyl-1-oxa-5-azacyclotetradecan-14-one |
|---|---|
| PubChem CID | 129313037 |
| Molecular Formula | C24H45NO9 |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | (3R,7R,12S)-3,4,9-trihydroxy-12-[(2R,4R,5S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,13-tetramethyl-1-oxa-5-azacyclotetradecan-14-one |
| SMILES | CO[C@]1(C)C[C@H](O[C@H]2CCC(O)C[C@@H](C)CN(C)C(O)[C@](C)(O)COC(=O)C2C)OC(C)[C@@H]1O |
| InChI | InChI=1S/C24H45NO9/c1-14-10-17(26)8-9-18(34-19-11-24(5,31-7)20(27)16(3)33-19)15(2)21(28)32-13-23(4,30)22(29)25(6)12-14/h14-20,22,26-27,29-30H,8-13H2,1-7H3/t14-,15?,16?,17?,18+,19+,20+,22?,23-,24-/m1/s1 |
| InChIKey | UEKNPHYTYBVVGZ-WSNVISOJSA-N |
| XLogP | 0.63 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |