C26H49NO7 — CID 143418416
(3R,8R,13S)-13-[(2S)-4,6-dimethyloxan-2-yl]oxy-3,10-dihydroxy-4-methoxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 143418416) has the molecular formula C26H49NO7 and a molecular weight of 487.68 g/mol. Its IUPAC name is (3R,8R,13S)-13-[(2S)-4,6-dimethyloxan-2-yl]oxy-3,10-dihydroxy-4-methoxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (3R,8R,13S)-13-[(2S)-4,6-dimethyloxan-2-yl]oxy-3,10-dihydroxy-4-methoxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 143418416 |
| Molecular Formula | C26H49NO7 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.35 |
| IUPAC Name | (3R,8R,13S)-13-[(2S)-4,6-dimethyloxan-2-yl]oxy-3,10-dihydroxy-4-methoxy-3,5,6,8,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | COC1C(C)N(C)C[C@H](C)CC(O)CC[C@H](O[C@H]2CC(C)CC(C)O2)C(C)C(=O)OC[C@@]1(C)O |
| InChI | InChI=1S/C26H49NO7/c1-16-11-18(3)33-23(13-16)34-22-10-9-21(28)12-17(2)14-27(7)20(5)24(31-8)26(6,30)15-32-25(29)19(22)4/h16-24,28,30H,9-15H2,1-8H3/t16?,17-,18?,19?,20?,21?,22+,23+,24?,26-/m1/s1 |
| InChIKey | IXDNLOGQYOWUBV-CWADVGCHSA-N |
| XLogP | 2.98 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |