C29H53ClN2O8 — CID 143937389
chloromethane;(3R,8R,11R)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3,4-dihydroxy-3,5,8,14-tetramethyl-10-prop-2-enoxy-1-oxa-7-azacyclopentadecane-6,15-dione (PubChem CID 143937389) has the molecular formula C29H53ClN2O8 and a molecular weight of 593.20 g/mol. Its IUPAC name is chloromethane;(3R,8R,11R)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3,4-dihydroxy-3,5,8,14-tetramethyl-10-prop-2-enoxy-1-oxa-7-azacyclopentadecane-6,15-dione.
| Compound Name | chloromethane;(3R,8R,11R)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3,4-dihydroxy-3,5,8,14-tetramethyl-10-prop-2-enoxy-1-oxa-7-azacyclopentadecane-6,15-dione |
|---|---|
| PubChem CID | 143937389 |
| Molecular Formula | C29H53ClN2O8 |
| Molecular Weight | 593.20 g/mol |
| Exact Mass | 592.35 |
| IUPAC Name | chloromethane;(3R,8R,11R)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-3,4-dihydroxy-3,5,8,14-tetramethyl-10-prop-2-enoxy-1-oxa-7-azacyclopentadecane-6,15-dione |
| SMILES | C=CCOC1C[C@@H](C)NC(=O)C(C)C(O)[C@](C)(O)COC(=O)C(C)CC[C@H]1OC1CC(N(C)C)CC(C)O1.CCl |
| InChI | InChI=1S/C28H50N2O8.CH3Cl/c1-9-12-35-23-13-18(3)29-26(32)20(5)25(31)28(6,34)16-36-27(33)17(2)10-11-22(23)38-24-15-21(30(7)8)14-19(4)37-24;1-2/h9,17-25,31,34H,1,10-16H2,2-8H3,(H,29,32);1H3/t17?,18-,19?,20?,21?,22-,23?,24?,25?,28-;/m1./s1 |
| InChIKey | CYAKAIODZZKUIR-LVKGEFCLSA-N |
| XLogP | 2.87 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|