C28H54N2O7 — CID 142182626
(2R,8R,10R,11R,12S)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 142182626) has the molecular formula C28H54N2O7 and a molecular weight of 530.75 g/mol. Its IUPAC name is (2R,8R,10R,11R,12S)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,8R,10R,11R,12S)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 142182626 |
| Molecular Formula | C28H54N2O7 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | (2R,8R,10R,11R,12S)-11-[4-(dimethylamino)-6-methyloxan-2-yl]oxy-2-ethyl-3,4,10-trihydroxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)C(C)C[C@H](C)[C@@H](OC2CC(N(C)C)CC(C)O2)[C@](C)(O)C[C@@H](C)CNC(C)C(O)C1O |
| InChI | InChI=1S/C28H54N2O7/c1-10-22-25(32)24(31)20(6)29-15-16(2)14-28(7,34)26(17(3)11-18(4)27(33)36-22)37-23-13-21(30(8)9)12-19(5)35-23/h16-26,29,31-32,34H,10-15H2,1-9H3/t16-,17+,18?,19?,20?,21?,22-,23?,24?,25?,26-,28-/m1/s1 |
| InChIKey | BSFPALDMQMCUKI-ABAYNIQGSA-N |
| XLogP | 2.30 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |