C28H53NO9 — CID 134365426
(2R,8R,10R,12R,13S)-2-ethyl-3,4,10-trihydroxy-13-[(4R,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 134365426) has the molecular formula C28H53NO9 and a molecular weight of 547.73 g/mol. Its IUPAC name is (2R,8R,10R,12R,13S)-2-ethyl-3,4,10-trihydroxy-13-[(4R,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | (2R,8R,10R,12R,13S)-2-ethyl-3,4,10-trihydroxy-13-[(4R,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 134365426 |
| Molecular Formula | C28H53NO9 |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.37 |
| IUPAC Name | (2R,8R,10R,12R,13S)-2-ethyl-3,4,10-trihydroxy-13-[(4R,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-5,8,10,12,14-pentamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CC[C@H]1OC(=O)C(C)[C@@H](OC2C[C@@](C)(OC)C(O)[C@H](C)O2)[C@H](C)C[C@](C)(O)C[C@@H](C)CNC(C)C(O)C1O |
| InChI | InChI=1S/C28H53NO9/c1-10-20-23(31)22(30)18(5)29-14-15(2)11-27(7,34)12-16(3)24(17(4)26(33)37-20)38-21-13-28(8,35-9)25(32)19(6)36-21/h15-25,29-32,34H,10-14H2,1-9H3/t15-,16-,17?,18?,19+,20-,21?,22?,23?,24+,25?,27-,28-/m1/s1 |
| InChIKey | GNWKZSBLEDKIBJ-KRKABVKFSA-N |
| XLogP | 1.75 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |