C30H57NO10 — CID 154606143
2-ethyl-2,3,4,10-tetrahydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one (PubChem CID 154606143) has the molecular formula C30H57NO10 and a molecular weight of 591.78 g/mol. Its IUPAC name is 2-ethyl-2,3,4,10-tetrahydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one.
| Compound Name | 2-ethyl-2,3,4,10-tetrahydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one |
|---|---|
| PubChem CID | 154606143 |
| Molecular Formula | C30H57NO10 |
| Molecular Weight | 591.78 g/mol |
| Exact Mass | 591.40 |
| IUPAC Name | 2-ethyl-2,3,4,10-tetrahydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one |
| SMILES | CCC1(O)OC(=O)C(C)C(O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)C(C)CC(C)(O)CC(C)CN(C)C(C)C(O)C1(C)O |
| InChI | InChI=1S/C30H57NO10/c1-12-30(37)29(9,36)24(32)20(5)31(10)16-17(2)13-27(7,35)14-18(3)23(19(4)26(34)41-30)40-22-15-28(8,38-11)25(33)21(6)39-22/h17-25,32-33,35-37H,12-16H2,1-11H3/t17?,18?,19?,20?,21-,22-,23?,24?,25-,27?,28+,29?,30?/m0/s1 |
| InChIKey | HHHUXBQCLVCCHV-PTVNOJSASA-N |
| XLogP | 1.80 |
| TPSA | 158.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.78 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |