C25H47NO7 — CID 143417773
cis-(2R,12S)-12-[(2S)-4,6-dimethyloxan-2-yl]oxy-2-ethyl-3,9-dihydroxy-4-methoxy-3,5,13-trimethyl-1-oxa-5-azacyclotetradecan-14-one (PubChem CID 143417773) has the molecular formula C25H47NO7 and a molecular weight of 473.65 g/mol. Its IUPAC name is cis-(2R,12S)-12-[(2S)-4,6-dimethyloxan-2-yl]oxy-2-ethyl-3,9-dihydroxy-4-methoxy-3,5,13-trimethyl-1-oxa-5-azacyclotetradecan-14-one.
| Compound Name | cis-(2R,12S)-12-[(2S)-4,6-dimethyloxan-2-yl]oxy-2-ethyl-3,9-dihydroxy-4-methoxy-3,5,13-trimethyl-1-oxa-5-azacyclotetradecan-14-one |
|---|---|
| PubChem CID | 143417773 |
| Molecular Formula | C25H47NO7 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | cis-(2R,12S)-12-[(2S)-4,6-dimethyloxan-2-yl]oxy-2-ethyl-3,9-dihydroxy-4-methoxy-3,5,13-trimethyl-1-oxa-5-azacyclotetradecan-14-one |
| SMILES | CC[C@H]1OC(=O)C(C)[C@@H](O[C@H]2CC(C)CC(C)O2)CCC(O)CCCN(C)C(OC)C1(C)O |
| InChI | InChI=1S/C25H47NO7/c1-8-21-25(5,29)24(30-7)26(6)13-9-10-19(27)11-12-20(18(4)23(28)33-21)32-22-15-16(2)14-17(3)31-22/h16-22,24,27,29H,8-15H2,1-7H3/t16?,17?,18?,19?,20-,21+,22-,24?,25?/m0/s1 |
| InChIKey | UHSCNDYUGCCJGP-WMMUJPMOSA-N |
| XLogP | 3.08 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |